C24H34FIN6O — CID 111148424
N-[2-(dimethylamino)ethyl]-3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111148424) has the molecular formula C24H34FIN6O and a molecular weight of 568.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111148424 |
| Molecular Formula | C24H34FIN6O |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(C(=O)NCCN(C)C)c1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C24H33FN6O.HI/c1-26-24(31-15-13-30(14-16-31)22-10-5-4-9-21(22)25)28-18-19-7-6-8-20(17-19)23(32)27-11-12-29(2)3;/h4-10,17H,11-16,18H2,1-3H3,(H,26,28)(H,27,32);1H |
| InChIKey | GNZTZSFZIVMQJN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|