C20H24FN5O — CID 111148783
4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide (PubChem CID 111148783) has the molecular formula C20H24FN5O and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111148783 |
| Molecular Formula | C20H24FN5O |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)cc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H24FN5O/c1-23-20(24-14-15-6-8-16(9-7-15)19(22)27)26-12-10-25(11-13-26)18-5-3-2-4-17(18)21/h2-9H,10-14H2,1H3,(H2,22,27)(H,23,24) |
| InChIKey | WGIVMHFPGJCELW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|