C20H26IN5O2 — CID 111185383
4-[[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111185383) has the molecular formula C20H26IN5O2 and a molecular weight of 495.37 g/mol. Its IUPAC name is 4-[[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | 4-[[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111185383 |
| Molecular Formula | C20H26IN5O2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 4-[[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)cc1)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C20H25N5O2.HI/c1-22-20(23-14-15-6-8-16(9-7-15)19(21)27)25-12-10-24(11-13-25)17-4-2-3-5-18(17)26;/h2-9,26H,10-14H2,1H3,(H2,21,27)(H,22,23);1H |
| InChIKey | XJKGQTZGYJWJBM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|