C24H35N5O — CID 111184554
N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111184554) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111184554 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCN(CC)Cc1ccc(CN/C(=N\C)N2CCN(c3ccccc3O)CC2)cc1 |
| InChI | InChI=1S/C24H35N5O/c1-4-27(5-2)19-21-12-10-20(11-13-21)18-26-24(25-3)29-16-14-28(15-17-29)22-8-6-7-9-23(22)30/h6-13,30H,4-5,14-19H2,1-3H3,(H,25,26) |
| InChIKey | MRHSSZSEUSBIAG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|