C20H23FIN5 — CID 111149253
N-[(4-cyanophenyl)methyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111149253) has the molecular formula C20H23FIN5 and a molecular weight of 479.34 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-cyanophenyl)methyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111149253 |
| Molecular Formula | C20H23FIN5 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C#N)cc1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C20H22FN5.HI/c1-23-20(24-15-17-8-6-16(14-22)7-9-17)26-12-10-25(11-13-26)19-5-3-2-4-18(19)21;/h2-9H,10-13,15H2,1H3,(H,23,24);1H |
| InChIKey | NBBQQFPQIMZKAI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|