C20H26N4O2S — CID 109488007
N-[3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 109488007) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 109488007 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)c2ccco2)c1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C20H26N4O2S/c1-20(2)14-24(9-11-27-20)19(21-3)22-13-15-6-4-7-16(12-15)23-18(25)17-8-5-10-26-17/h4-8,10,12H,9,11,13-14H2,1-3H3,(H,21,22)(H,23,25) |
| InChIKey | OOTGDUFZLJYWNT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|