C16H24N4OS — CID 109487783
3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide (PubChem CID 109487783) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is 3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide.
| Compound Name | 3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109487783 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1cccc(C(N)=O)c1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C16H24N4OS/c1-16(2)11-20(7-8-22-16)15(18-3)19-10-12-5-4-6-13(9-12)14(17)21/h4-6,9H,7-8,10-11H2,1-3H3,(H2,17,21)(H,18,19) |
| InChIKey | QJBPCRMNECHFLJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|