C20H33IN4OS — CID 109488338
N-butan-2-yl-3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 109488338) has the molecular formula C20H33IN4OS and a molecular weight of 504.48 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109488338 |
| Molecular Formula | C20H33IN4OS |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-butan-2-yl-3-[[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | CCC(C)NC(=O)c1cccc(CN/C(=N\C)N2CCSC(C)(C)C2)c1.I |
| InChI | InChI=1S/C20H32N4OS.HI/c1-6-15(2)23-18(25)17-9-7-8-16(12-17)13-22-19(21-5)24-10-11-26-20(3,4)14-24;/h7-9,12,15H,6,10-11,13-14H2,1-5H3,(H,21,22)(H,23,25);1H |
| InChIKey | XCNWVIDAWJUYPB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|