C16H26IN3S — CID 109489910
N',2,2-trimethyl-N-[(4-methylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109489910) has the molecular formula C16H26IN3S and a molecular weight of 419.38 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[(4-methylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N',2,2-trimethyl-N-[(4-methylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109489910 |
| Molecular Formula | C16H26IN3S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N',2,2-trimethyl-N-[(4-methylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C)cc1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C16H25N3S.HI/c1-13-5-7-14(8-6-13)11-18-15(17-4)19-9-10-20-16(2,3)12-19;/h5-8H,9-12H2,1-4H3,(H,17,18);1H |
| InChIKey | BDWPJGNJPCBBFQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|