C17H28N4O2S2 — CID 109488271
N',2,2-trimethyl-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 109488271) has the molecular formula C17H28N4O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488271 |
| Molecular Formula | C17H28N4O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N',2,2-trimethyl-N-[[4-(methylsulfamoylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(CS(=O)(=O)NC)cc1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H28N4O2S2/c1-17(2)13-21(9-10-24-17)16(18-3)20-11-14-5-7-15(8-6-14)12-25(22,23)19-4/h5-8,19H,9-13H2,1-4H3,(H,18,20) |
| InChIKey | CZZGETAUKBFUEA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|