C21H34N4OS — CID 109489719
N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109489719) has the molecular formula C21H34N4OS and a molecular weight of 390.60 g/mol. Its IUPAC name is N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489719 |
| Molecular Formula | C21H34N4OS |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(CN2CCC(O)CC2)cc1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C21H34N4OS/c1-21(2)16-25(12-13-27-21)20(22-3)23-14-17-4-6-18(7-5-17)15-24-10-8-19(26)9-11-24/h4-7,19,26H,8-16H2,1-3H3,(H,22,23) |
| InChIKey | ALLGLMKKJUHGCO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|