C20H32N4S — CID 109489059
N',2,2-trimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 109489059) has the molecular formula C20H32N4S and a molecular weight of 360.57 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489059 |
| Molecular Formula | C20H32N4S |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N',2,2-trimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(CN2CCCC2)cc1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C20H32N4S/c1-20(2)16-24(12-13-25-20)19(21-3)22-14-17-6-8-18(9-7-17)15-23-10-4-5-11-23/h6-9H,4-5,10-16H2,1-3H3,(H,21,22) |
| InChIKey | UPUMAHNATFHHLG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|