C16H22FN5O2 — CID 119115845
2-[[C-(4-acetylpiperazin-1-yl)-N-methylcarbonimidoyl]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 119115845) has the molecular formula C16H22FN5O2 and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[[C-(4-acetylpiperazin-1-yl)-N-methylcarbonimidoyl]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[C-(4-acetylpiperazin-1-yl)-N-methylcarbonimidoyl]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 119115845 |
| Molecular Formula | C16H22FN5O2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[[C-(4-acetylpiperazin-1-yl)-N-methylcarbonimidoyl]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1cccc(F)c1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H22FN5O2/c1-12(23)21-6-8-22(9-7-21)16(18-2)19-11-15(24)20-14-5-3-4-13(17)10-14/h3-5,10H,6-9,11H2,1-2H3,(H,18,19)(H,20,24) |
| InChIKey | WJYTUAQVYAPLFX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|