C18H22FN7O2 — CID 109435541
N-(3-fluorophenyl)-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide (PubChem CID 109435541) has the molecular formula C18H22FN7O2 and a molecular weight of 387.42 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 109435541 |
| Molecular Formula | C18H22FN7O2 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-(3-fluorophenyl)-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1cccc(F)c1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H22FN7O2/c1-20-18(21-10-16(27)23-14-5-3-4-13(19)8-14)25-6-7-26(17(28)12-25)15-9-22-24(2)11-15/h3-5,8-9,11H,6-7,10,12H2,1-2H3,(H,20,21)(H,23,27) |
| InChIKey | OTBHCVCCYUVHRI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|