C17H23N7O — CID 109435545
N'-methyl-4-(1-methylpyrazol-4-yl)-N-[(6-methyl-2-pyridinyl)methyl]-3-oxopiperazine-1-carboximidamide (PubChem CID 109435545) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-N-[(6-methyl-2-pyridinyl)methyl]-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[(6-methyl-2-pyridinyl)methyl]-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435545 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-N-[(6-methyl-2-pyridinyl)methyl]-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(C)n1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C17H23N7O/c1-13-5-4-6-14(21-13)9-19-17(18-2)23-7-8-24(16(25)12-23)15-10-20-22(3)11-15/h4-6,10-11H,7-9,12H2,1-3H3,(H,18,19) |
| InChIKey | GDJCURDLHRXLNM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|