C15H21IN6OS — CID 109435074
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(thiophen-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109435074) has the molecular formula C15H21IN6OS and a molecular weight of 460.35 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(thiophen-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(thiophen-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109435074 |
| Molecular Formula | C15H21IN6OS |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-(thiophen-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccsc1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C15H20N6OS.HI/c1-16-15(17-7-12-3-6-23-11-12)20-4-5-21(14(22)10-20)13-8-18-19(2)9-13;/h3,6,8-9,11H,4-5,7,10H2,1-2H3,(H,16,17);1H |
| InChIKey | HCFKNLPBSCZJPJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|