C18H23FN6O2 — CID 109435965
N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435965) has the molecular formula C18H23FN6O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435965 |
| Molecular Formula | C18H23FN6O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(OC)c(F)c1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H23FN6O2/c1-20-18(21-9-13-4-5-16(27-3)15(19)8-13)24-6-7-25(17(26)12-24)14-10-22-23(2)11-14/h4-5,8,10-11H,6-7,9,12H2,1-3H3,(H,20,21) |
| InChIKey | YILVCLARQPPNMP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|