C20H26F2N6O3 — CID 109434007
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109434007) has the molecular formula C20H26F2N6O3 and a molecular weight of 436.46 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109434007 |
| Molecular Formula | C20H26F2N6O3 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCOc1cc(CN/C(=N\C)N2CCN(c3cnn(C)c3)C(=O)C2)ccc1OC(F)F |
| InChI | InChI=1S/C20H26F2N6O3/c1-4-30-17-9-14(5-6-16(17)31-19(21)22)10-24-20(23-2)27-7-8-28(18(29)13-27)15-11-25-26(3)12-15/h5-6,9,11-12,19H,4,7-8,10,13H2,1-3H3,(H,23,24) |
| InChIKey | SATGXGQRWCDHJZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|