C20H26F2N6O2 — CID 111206808
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111206808) has the molecular formula C20H26F2N6O2 and a molecular weight of 420.46 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111206808 |
| Molecular Formula | C20H26F2N6O2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCOc1cc(CN/C(=N/C)N2CCN(c3ncccn3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C20H26F2N6O2/c1-3-29-17-13-15(5-6-16(17)30-18(21)22)14-26-19(23-2)27-9-11-28(12-10-27)20-24-7-4-8-25-20/h4-8,13,18H,3,9-12,14H2,1-2H3,(H,23,26) |
| InChIKey | JFPFRRALKMMGEO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|