C22H28F2N4O3 — CID 111184624
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111184624) has the molecular formula C22H28F2N4O3 and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111184624 |
| Molecular Formula | C22H28F2N4O3 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(2-hydroxyphenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCOc1cc(CN/C(=N/C)N2CCN(c3ccccc3O)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C22H28F2N4O3/c1-3-30-20-14-16(8-9-19(20)31-21(23)24)15-26-22(25-2)28-12-10-27(11-13-28)17-6-4-5-7-18(17)29/h4-9,14,21,29H,3,10-13,15H2,1-2H3,(H,25,26) |
| InChIKey | IYMXZYMFVVJBFY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|