C19H27IN6O — CID 111207995
N-[(4-methoxy-3-methylphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111207995) has the molecular formula C19H27IN6O and a molecular weight of 482.37 g/mol. Its IUPAC name is N-[(4-methoxy-3-methylphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-methoxy-3-methylphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111207995 |
| Molecular Formula | C19H27IN6O |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-[(4-methoxy-3-methylphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)c(C)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C19H26N6O.HI/c1-15-13-16(5-6-17(15)26-3)14-23-18(20-2)24-9-11-25(12-10-24)19-21-7-4-8-22-19;/h4-8,13H,9-12,14H2,1-3H3,(H,20,23);1H |
| InChIKey | NBRIRLNWZUYMDF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|