C21H30N6O2 — CID 111207482
N-[(3-methoxy-4-propoxyphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207482) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[(3-methoxy-4-propoxyphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207482 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-N'-methyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCCOc1ccc(CN/C(=N/C)N2CCN(c3ncccn3)CC2)cc1OC |
| InChI | InChI=1S/C21H30N6O2/c1-4-14-29-18-7-6-17(15-19(18)28-3)16-25-20(22-2)26-10-12-27(13-11-26)21-23-8-5-9-24-21/h5-9,15H,4,10-14,16H2,1-3H3,(H,22,25) |
| InChIKey | VOJGCWCELIFYMA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|