C23H33N5O2 — CID 111221413
N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111221413) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111221413 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N-ethyl-N'-[(3-methoxy-4-propoxyphenyl)methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCCOc1ccc(C/N=C(\NCC)N2CCN(c3ccccn3)CC2)cc1OC |
| InChI | InChI=1S/C23H33N5O2/c1-4-16-30-20-10-9-19(17-21(20)29-3)18-26-23(24-5-2)28-14-12-27(13-15-28)22-8-6-7-11-25-22/h6-11,17H,4-5,12-16,18H2,1-3H3,(H,24,26) |
| InChIKey | YSTMMDWBHVMIDL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|