C22H29F2N5O2 — CID 111220041
N'-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111220041) has the molecular formula C22H29F2N5O2 and a molecular weight of 433.50 g/mol. Its IUPAC name is N'-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111220041 |
| Molecular Formula | C22H29F2N5O2 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N'-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC(F)F)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H29F2N5O2/c1-3-25-22(29-14-12-28(13-15-29)20-6-4-5-10-26-20)27-11-9-17-7-8-18(30-2)19(16-17)31-21(23)24/h4-8,10,16,21H,3,9,11-15H2,1-2H3,(H,25,27) |
| InChIKey | RRZLTLDDWAPRRU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|