C15H23F3IN5 — CID 111983962
N-ethyl-4-pyridin-2-yl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111983962) has the molecular formula C15H23F3IN5 and a molecular weight of 457.28 g/mol. Its IUPAC name is N-ethyl-4-pyridin-2-yl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-pyridin-2-yl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111983962 |
| Molecular Formula | C15H23F3IN5 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-ethyl-4-pyridin-2-yl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C15H22F3N5.HI/c1-2-19-14(21-8-6-15(16,17)18)23-11-9-22(10-12-23)13-5-3-4-7-20-13;/h3-5,7H,2,6,8-12H2,1H3,(H,19,21);1H |
| InChIKey | PMDODKPRCOWTFU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|