C20H26F3N7 — CID 111220649
N-ethyl-4-pyridin-2-yl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperazine-1-carboximidamide (PubChem CID 111220649) has the molecular formula C20H26F3N7 and a molecular weight of 421.47 g/mol. Its IUPAC name is N-ethyl-4-pyridin-2-yl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-pyridin-2-yl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111220649 |
| Molecular Formula | C20H26F3N7 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-ethyl-4-pyridin-2-yl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNc1ncccc1C(F)(F)F)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26F3N7/c1-2-24-19(30-14-12-29(13-15-30)17-7-3-4-8-25-17)28-11-10-27-18-16(20(21,22)23)6-5-9-26-18/h3-9H,2,10-15H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | FWAAFIYXWZQUOJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|