C17H28N6O — CID 111220489
3-[[ethylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 111220489) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[[ethylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[ethylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111220489 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 3-[[ethylamino-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H28N6O/c1-4-19-16(21-13-17(2,3)15(18)24)23-11-9-22(10-12-23)14-7-5-6-8-20-14/h5-8H,4,9-13H2,1-3H3,(H2,18,24)(H,19,21) |
| InChIKey | XUPQGFNJSFXCDB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|