C16H22ClF3N4 — CID 111983859
4-(2-chlorophenyl)-N-ethyl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide (PubChem CID 111983859) has the molecular formula C16H22ClF3N4 and a molecular weight of 362.83 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-ethyl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N-ethyl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111983859 |
| Molecular Formula | C16H22ClF3N4 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-(2-chlorophenyl)-N-ethyl-N'-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClF3N4/c1-2-21-15(22-8-7-16(18,19)20)24-11-9-23(10-12-24)14-6-4-3-5-13(14)17/h3-6H,2,7-12H2,1H3,(H,21,22) |
| InChIKey | QSBRSZFMBHDIAU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|