C18H27ClN4O2S — CID 111177360
4-(2-chlorophenyl)-N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 111177360) has the molecular formula C18H27ClN4O2S and a molecular weight of 398.96 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177360 |
| Molecular Formula | C18H27ClN4O2S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-(2-chlorophenyl)-N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H27ClN4O2S/c1-2-20-18(21-13-15-7-12-26(24,25)14-15)23-10-8-22(9-11-23)17-6-4-3-5-16(17)19/h3-6,15H,2,7-14H2,1H3,(H,20,21) |
| InChIKey | ZDWCCNUJJYTSHQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|