C16H31IN4O3S — CID 119132417
N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119132417) has the molecular formula C16H31IN4O3S and a molecular weight of 486.42 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119132417 |
| Molecular Formula | C16H31IN4O3S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)N1CCN(C(=O)C(C)C)CC1.I |
| InChI | InChI=1S/C16H30N4O3S.HI/c1-4-17-16(18-11-14-5-10-24(22,23)12-14)20-8-6-19(7-9-20)15(21)13(2)3;/h13-14H,4-12H2,1-3H3,(H,17,18);1H |
| InChIKey | PTMSGOQQACWJFL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|