C15H28IN3O2S — CID 119130079
N'-[(1,1-dioxothiolan-3-yl)methyl]-3-methyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 119130079) has the molecular formula C15H28IN3O2S and a molecular weight of 441.38 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-3-methyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-3-methyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119130079 |
| Molecular Formula | C15H28IN3O2S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-3-methyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC1CCS(=O)(=O)C1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C15H27N3O2S.HI/c1-3-7-16-15(18-8-4-5-13(2)11-18)17-10-14-6-9-21(19,20)12-14;/h3,13-14H,1,4-12H2,2H3,(H,16,17);1H |
| InChIKey | HMQVIJSTPVPWTN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|