C18H33IN4O2S — CID 119143095
N'-[(1,1-dioxothiolan-3-yl)methyl]-3-piperidin-1-yl-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119143095) has the molecular formula C18H33IN4O2S and a molecular weight of 496.46 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-3-piperidin-1-yl-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-3-piperidin-1-yl-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119143095 |
| Molecular Formula | C18H33IN4O2S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-3-piperidin-1-yl-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC1CCS(=O)(=O)C1)N1CCC(N2CCCCC2)C1.I |
| InChI | InChI=1S/C18H32N4O2S.HI/c1-2-8-19-18(20-13-16-7-12-25(23,24)15-16)22-11-6-17(14-22)21-9-4-3-5-10-21;/h2,16-17H,1,3-15H2,(H,19,20);1H |
| InChIKey | IEEAXYWFAQMDHL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|