C17H26N6O2S — CID 119130788
N'-[(1,1-dioxothiolan-3-yl)methyl]-N-prop-2-enyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 119130788) has the molecular formula C17H26N6O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-N-prop-2-enyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-N-prop-2-enyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119130788 |
| Molecular Formula | C17H26N6O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-N-prop-2-enyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\CC1CCS(=O)(=O)C1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H26N6O2S/c1-2-5-18-17(21-13-15-4-12-26(24,25)14-15)23-10-8-22(9-11-23)16-19-6-3-7-20-16/h2-3,6-7,15H,1,4-5,8-14H2,(H,18,21) |
| InChIKey | MLWDSUHIWZFTJD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|