C16H30IN3O2S — CID 119130205
N'-[(1,1-dioxothiolan-3-yl)methyl]-3,5-dimethyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 119130205) has the molecular formula C16H30IN3O2S and a molecular weight of 455.41 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-3,5-dimethyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-3,5-dimethyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119130205 |
| Molecular Formula | C16H30IN3O2S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-3,5-dimethyl-N-prop-2-enylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC1CCS(=O)(=O)C1)N1CC(C)CC(C)C1.I |
| InChI | InChI=1S/C16H29N3O2S.HI/c1-4-6-17-16(19-10-13(2)8-14(3)11-19)18-9-15-5-7-22(20,21)12-15;/h4,13-15H,1,5-12H2,2-3H3,(H,17,18);1H |
| InChIKey | XCJPEUTUKCEZRK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|