C14H28IN3 — CID 111153504
N'-(cyclopropylmethyl)-N-ethyl-3,5-dimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111153504) has the molecular formula C14H28IN3 and a molecular weight of 365.30 g/mol. Its IUPAC name is N'-(cyclopropylmethyl)-N-ethyl-3,5-dimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(cyclopropylmethyl)-N-ethyl-3,5-dimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111153504 |
| Molecular Formula | C14H28IN3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N'-(cyclopropylmethyl)-N-ethyl-3,5-dimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CC1)N1CC(C)CC(C)C1.I |
| InChI | InChI=1S/C14H27N3.HI/c1-4-15-14(16-8-13-5-6-13)17-9-11(2)7-12(3)10-17;/h11-13H,4-10H2,1-3H3,(H,15,16);1H |
| InChIKey | USQMRZKWTADVJN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|