C11H22IN3O — CID 111549681
(3R)-N'-(cyclopropylmethyl)-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111549681) has the molecular formula C11H22IN3O and a molecular weight of 339.22 g/mol. Its IUPAC name is (3R)-N'-(cyclopropylmethyl)-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | (3R)-N'-(cyclopropylmethyl)-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111549681 |
| Molecular Formula | C11H22IN3O |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (3R)-N'-(cyclopropylmethyl)-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CC1)N1CC[C@@H](O)C1.I |
| InChI | InChI=1S/C11H21N3O.HI/c1-2-12-11(13-7-9-3-4-9)14-6-5-10(15)8-14;/h9-10,15H,2-8H2,1H3,(H,12,13);1H/t10-;/m1./s1 |
| InChIKey | JURNPGNVPJOOEO-HNCPQSOCSA-N |
| XLogP | 1.05 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|