C16H30N4O — CID 111549978
(3R)-N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide (PubChem CID 111549978) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is (3R)-N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111549978 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (3R)-N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN(CC1CC1)C1CC1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C16H30N4O/c1-2-17-16(20-9-7-15(21)12-20)18-8-10-19(14-5-6-14)11-13-3-4-13/h13-15,21H,2-12H2,1H3,(H,17,18)/t15-/m1/s1 |
| InChIKey | MZZJPHSFSPTTGH-OAHLLOKOSA-N |
| XLogP | 0.89 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|