C14H28N4 — CID 110956268
N'-[2-[cyclopropyl(ethyl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 110956268) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N'-[2-[cyclopropyl(ethyl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-[cyclopropyl(ethyl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110956268 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N'-[2-[cyclopropyl(ethyl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN(CC)C1CC1)N1CCCC1 |
| InChI | InChI=1S/C14H28N4/c1-3-15-14(18-10-5-6-11-18)16-9-12-17(4-2)13-7-8-13/h13H,3-12H2,1-2H3,(H,15,16) |
| InChIKey | INTDBEMWSKUGQB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|