C15H32N4 — CID 110955978
N'-[2-[di(propan-2-yl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 110955978) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is N'-[2-[di(propan-2-yl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-[di(propan-2-yl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110955978 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | N'-[2-[di(propan-2-yl)amino]ethyl]-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN(C(C)C)C(C)C)N1CCCC1 |
| InChI | InChI=1S/C15H32N4/c1-6-16-15(18-10-7-8-11-18)17-9-12-19(13(2)3)14(4)5/h13-14H,6-12H2,1-5H3,(H,16,17) |
| InChIKey | WGBDADINFNIQNO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|