C10H22N4O3S — CID 111550680
(3R)-N-ethyl-3-hydroxy-N'-[2-(methanesulfonamido)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111550680) has the molecular formula C10H22N4O3S and a molecular weight of 278.38 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-[2-(methanesulfonamido)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-[2-(methanesulfonamido)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111550680 |
| Molecular Formula | C10H22N4O3S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-[2-(methanesulfonamido)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C10H22N4O3S/c1-3-11-10(14-7-4-9(15)8-14)12-5-6-13-18(2,16)17/h9,13,15H,3-8H2,1-2H3,(H,11,12)/t9-/m1/s1 |
| InChIKey | GQYJCWWPTVINCI-SECBINFHSA-N |
| XLogP | -1.43 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|