C16H25FN4O3S — CID 111550332
(3R)-N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-3-hydroxypyrrolidine-1-carboximidamide (PubChem CID 111550332) has the molecular formula C16H25FN4O3S and a molecular weight of 372.47 g/mol. Its IUPAC name is (3R)-N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-3-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-3-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111550332 |
| Molecular Formula | C16H25FN4O3S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (3R)-N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-3-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)Nc1ccc(C)c(F)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C16H25FN4O3S/c1-3-18-16(21-8-6-14(22)11-21)19-7-9-25(23,24)20-13-5-4-12(2)15(17)10-13/h4-5,10,14,20,22H,3,6-9,11H2,1-2H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | OYZCOCLIMNBTTM-CQSZACIVSA-N |
| XLogP | 0.91 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|