C18H30FIN4O3S — CID 111958290
4-ethoxy-N-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111958290) has the molecular formula C18H30FIN4O3S and a molecular weight of 528.43 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111958290 |
| Molecular Formula | C18H30FIN4O3S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 4-ethoxy-N-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N\C)NCCS(=O)(=O)Nc2ccc(C)c(F)c2)CC1.I |
| InChI | InChI=1S/C18H29FN4O3S.HI/c1-4-26-16-7-10-23(11-8-16)18(20-3)21-9-12-27(24,25)22-15-6-5-14(2)17(19)13-15;/h5-6,13,16,22H,4,7-12H2,1-3H3,(H,20,21);1H |
| InChIKey | SGSQYZFCRMGJFH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|