C17H28IN5O3 — CID 111959186
4-ethoxy-N'-methyl-N-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111959186) has the molecular formula C17H28IN5O3 and a molecular weight of 477.35 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N'-methyl-N-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959186 |
| Molecular Formula | C17H28IN5O3 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N\C)NCCNc2ccc([N+](=O)[O-])cc2)CC1.I |
| InChI | InChI=1S/C17H27N5O3.HI/c1-3-25-16-8-12-21(13-9-16)17(18-2)20-11-10-19-14-4-6-15(7-5-14)22(23)24;/h4-7,16,19H,3,8-13H2,1-2H3,(H,18,20);1H |
| InChIKey | NSCOXQXDTFEFHX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|