C18H30IN5O3 — CID 111959032
4-ethoxy-N-ethyl-N'-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111959032) has the molecular formula C18H30IN5O3 and a molecular weight of 491.37 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959032 |
| Molecular Formula | C18H30IN5O3 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[2-(4-nitroanilino)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ccc([N+](=O)[O-])cc1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C18H29N5O3.HI/c1-3-19-18(22-13-9-17(10-14-22)26-4-2)21-12-11-20-15-5-7-16(8-6-15)23(24)25;/h5-8,17,20H,3-4,9-14H2,1-2H3,(H,19,21);1H |
| InChIKey | VYQNYIMRRRRTTL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|