C23H33IN6O2 — CID 110987035
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 110987035) has the molecular formula C23H33IN6O2 and a molecular weight of 552.46 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110987035 |
| Molecular Formula | C23H33IN6O2 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ccc([N+](=O)[O-])cc1)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H32N6O2.HI/c1-2-24-23(26-15-14-25-20-8-10-22(11-9-20)29(30)31)27-21-12-16-28(17-13-21)18-19-6-4-3-5-7-19;/h3-11,21,25H,2,12-18H2,1H3,(H2,24,26,27);1H |
| InChIKey | PZWJSFOZRICUFW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|