C20H34IN3O — CID 111958824
4-ethoxy-N-ethyl-N'-(3-phenylbutyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 111958824) has the molecular formula C20H34IN3O and a molecular weight of 459.42 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-(3-phenylbutyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-(3-phenylbutyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111958824 |
| Molecular Formula | C20H34IN3O |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-(3-phenylbutyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(C)c1ccccc1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C20H33N3O.HI/c1-4-21-20(23-15-12-19(13-16-23)24-5-2)22-14-11-17(3)18-9-7-6-8-10-18;/h6-10,17,19H,4-5,11-16H2,1-3H3,(H,21,22);1H |
| InChIKey | QPYZYTJGJFEEGZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|