C17H36IN3O2 — CID 111959036
4-ethoxy-N-ethyl-N'-[3-(2-methylpropoxy)propyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111959036) has the molecular formula C17H36IN3O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[3-(2-methylpropoxy)propyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[3-(2-methylpropoxy)propyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959036 |
| Molecular Formula | C17H36IN3O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[3-(2-methylpropoxy)propyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC(C)C)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C17H35N3O2.HI/c1-5-18-17(19-10-7-13-21-14-15(3)4)20-11-8-16(9-12-20)22-6-2;/h15-16H,5-14H2,1-4H3,(H,18,19);1H |
| InChIKey | FUIFTHHRPPLJRH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|