C21H42N4O3 — CID 111960643
tert-butyl N-[3-[[(4-ethoxypiperidin-1-yl)-(ethylamino)methylidene]amino]propyl]-N-propan-2-ylcarbamate (PubChem CID 111960643) has the molecular formula C21H42N4O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is tert-butyl N-[3-[[(4-ethoxypiperidin-1-yl)-(ethylamino)methylidene]amino]propyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[3-[[(4-ethoxypiperidin-1-yl)-(ethylamino)methylidene]amino]propyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 111960643 |
| Molecular Formula | C21H42N4O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | tert-butyl N-[3-[[(4-ethoxypiperidin-1-yl)-(ethylamino)methylidene]amino]propyl]-N-propan-2-ylcarbamate |
| SMILES | CCN/C(=N\CCCN(C(=O)OC(C)(C)C)C(C)C)N1CCC(OCC)CC1 |
| InChI | InChI=1S/C21H42N4O3/c1-8-22-19(24-15-11-18(12-16-24)27-9-2)23-13-10-14-25(17(3)4)20(26)28-21(5,6)7/h17-18H,8-16H2,1-7H3,(H,22,23) |
| InChIKey | LEYQBBFYLDEUOR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|