C16H35IN4O2 — CID 111959650
4-ethoxy-N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111959650) has the molecular formula C16H35IN4O2 and a molecular weight of 442.39 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959650 |
| Molecular Formula | C16H35IN4O2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CCOC)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C16H34N4O2.HI/c1-5-17-16(18-9-12-19(3)13-14-21-4)20-10-7-15(8-11-20)22-6-2;/h15H,5-14H2,1-4H3,(H,17,18);1H |
| InChIKey | ILJVWUGSCAZRLS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|