C15H33IN4O — CID 111738961
N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111738961) has the molecular formula C15H33IN4O and a molecular weight of 412.36 g/mol. Its IUPAC name is N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111738961 |
| Molecular Formula | C15H33IN4O |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-ethyl-N'-[2-[2-methoxyethyl(methyl)amino]ethyl]-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CCOC)N1CCC(C)(C)C1.I |
| InChI | InChI=1S/C15H32N4O.HI/c1-6-16-14(19-9-7-15(2,3)13-19)17-8-10-18(4)11-12-20-5;/h6-13H2,1-5H3,(H,16,17);1H |
| InChIKey | FYROBXLSKCSENN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|